C15H15F2N3O3 — CID 97320969
(1S,2R)-1-(2,6-difluorophenyl)-2-[(6-methyl-5-nitro-2-pyridinyl)amino]propan-1-ol (PubChem CID 97320969) has the molecular formula C15H15F2N3O3 and a molecular weight of 323.30 g/mol. Its IUPAC name is (1S,2R)-1-(2,6-difluorophenyl)-2-[(6-methyl-5-nitro-2-pyridinyl)amino]propan-1-ol.
| Compound Name | (1S,2R)-1-(2,6-difluorophenyl)-2-[(6-methyl-5-nitro-2-pyridinyl)amino]propan-1-ol |
|---|---|
| PubChem CID | 97320969 |
| Molecular Formula | C15H15F2N3O3 |
| Molecular Weight | 323.30 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | (1S,2R)-1-(2,6-difluorophenyl)-2-[(6-methyl-5-nitro-2-pyridinyl)amino]propan-1-ol |
| SMILES | Cc1nc(N[C@H](C)[C@@H](O)c2c(F)cccc2F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H15F2N3O3/c1-8-12(20(22)23)6-7-13(18-8)19-9(2)15(21)14-10(16)4-3-5-11(14)17/h3-7,9,15,21H,1-2H3,(H,18,19)/t9-,15-/m1/s1 |
| InChIKey | JHZFXFZQMKMUMK-RFAUZJTJSA-N |
| XLogP | 3.11 |
| TPSA | 88.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.30 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|