C15H22BrN3O — CID 97321060
(2S)-1-[4-(5-bromo-2-pyridinyl)piperazin-1-yl]hex-5-en-2-ol (PubChem CID 97321060) has the molecular formula C15H22BrN3O and a molecular weight of 340.27 g/mol. Its IUPAC name is (2S)-1-[4-(5-bromo-2-pyridinyl)piperazin-1-yl]hex-5-en-2-ol.
| Compound Name | (2S)-1-[4-(5-bromo-2-pyridinyl)piperazin-1-yl]hex-5-en-2-ol |
|---|---|
| PubChem CID | 97321060 |
| Molecular Formula | C15H22BrN3O |
| Molecular Weight | 340.27 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | (2S)-1-[4-(5-bromo-2-pyridinyl)piperazin-1-yl]hex-5-en-2-ol |
| SMILES | C=CCC[C@H](O)CN1CCN(c2ccc(Br)cn2)CC1 |
| InChI | InChI=1S/C15H22BrN3O/c1-2-3-4-14(20)12-18-7-9-19(10-8-18)15-6-5-13(16)11-17-15/h2,5-6,11,14,20H,1,3-4,7-10,12H2/t14-/m0/s1 |
| InChIKey | PUFJPJYMPLITFZ-AWEZNQCLSA-N |
| XLogP | 2.29 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.27 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|