C19H23N7O2 — CID 97321175
1-(4-methylphenyl)-3-[(3S)-3-(5-methyl-1H-1,2,4-triazol-3-yl)piperidine-1-carbonyl]-2,5-dihydro-1,2,4-triazin-6-one (PubChem CID 97321175) has the molecular formula C19H23N7O2 and a molecular weight of 381.44 g/mol. Its IUPAC name is 1-(4-methylphenyl)-3-[(3S)-3-(5-methyl-1H-1,2,4-triazol-3-yl)piperidine-1-carbonyl]-2,5-dihydro-1,2,4-triazin-6-one.
| Compound Name | 1-(4-methylphenyl)-3-[(3S)-3-(5-methyl-1H-1,2,4-triazol-3-yl)piperidine-1-carbonyl]-2,5-dihydro-1,2,4-triazin-6-one |
|---|---|
| PubChem CID | 97321175 |
| Molecular Formula | C19H23N7O2 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 1-(4-methylphenyl)-3-[(3S)-3-(5-methyl-1H-1,2,4-triazol-3-yl)piperidine-1-carbonyl]-2,5-dihydro-1,2,4-triazin-6-one |
| SMILES | Cc1ccc(N2NC(C(=O)N3CCC[C@H](c4n[nH]c(C)n4)C3)=NCC2=O)cc1 |
| InChI | InChI=1S/C19H23N7O2/c1-12-5-7-15(8-6-12)26-16(27)10-20-18(24-26)19(28)25-9-3-4-14(11-25)17-21-13(2)22-23-17/h5-8,14H,3-4,9-11H2,1-2H3,(H,20,24)(H,21,22,23)/t14-/m0/s1 |
| InChIKey | POWRHQGFZPVZEI-AWEZNQCLSA-N |
| XLogP | 1.08 |
| TPSA | 106.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |