About (1S)-N-[2-[4-(3,5-dimethylpyrazol-1-yl)phenyl]ethyl]-1-pyrazin-2-ylethanamine
(1S)-N-[2-[4-(3,5-dimethylpyrazol-1-yl)phenyl]ethyl]-1-pyrazin-2-ylethanamine (PubChem CID 97321808) has the molecular formula C19H23N5
and a molecular weight of 321.43 g/mol. Its IUPAC name is (1S)-N-[2-[4-(3,5-dimethylpyrazol-1-yl)phenyl]ethyl]-1-pyrazin-2-ylethanamine.
Molecular Properties
| Compound Name | (1S)-N-[2-[4-(3,5-dimethylpyrazol-1-yl)phenyl]ethyl]-1-pyrazin-2-ylethanamine |
| PubChem CID | 97321808 |
| Molecular Formula | C19H23N5 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.20 |
| IUPAC Name | (1S)-N-[2-[4-(3,5-dimethylpyrazol-1-yl)phenyl]ethyl]-1-pyrazin-2-ylethanamine |
| SMILES | Cc1cc(C)n(-c2ccc(CCN[C@@H](C)c3cnccn3)cc2)n1 |
| InChI | InChI=1S/C19H23N5/c1-14-12-15(2)24(23-14)18-6-4-17(5-7-18)8-9-21-16(3)19-13-20-10-11-22-19/h4-7,10-13,16,21H,8-9H2,1-3H3/t16-/m0/s1 |
| InChIKey | UHAVRUVMICTWHA-INIZCTEOSA-N |
| XLogP | 3.17 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1S)-N-[2-[4-(3,5-dimethylpyrazol-1-yl)phenyl]ethyl]-1-pyrazin-2-ylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-N-[2-[4-(3,5-dimethylpyrazol-1-yl)phenyl]ethyl]-1-pyrazin-2-ylethanamine?
The IUPAC name of (1S)-N-[2-[4-(3,5-dimethylpyrazol-1-yl)phenyl]ethyl]-1-pyrazin-2-ylethanamine (CID 97321808) is (1S)-N-[2-[4-(3,5-dimethylpyrazol-1-yl)phenyl]ethyl]-1-pyrazin-2-ylethanamine.
What is the SMILES notation for (1S)-N-[2-[4-(3,5-dimethylpyrazol-1-yl)phenyl]ethyl]-1-pyrazin-2-ylethanamine?
The canonical SMILES for (1S)-N-[2-[4-(3,5-dimethylpyrazol-1-yl)phenyl]ethyl]-1-pyrazin-2-ylethanamine is Cc1cc(C)n(-c2ccc(CCN[C@@H](C)c3cnccn3)cc2)n1.
What is the InChIKey of (1S)-N-[2-[4-(3,5-dimethylpyrazol-1-yl)phenyl]ethyl]-1-pyrazin-2-ylethanamine?
The InChIKey is UHAVRUVMICTWHA-INIZCTEOSA-N. The full InChI is InChI=1S/C19H23N5/c1-14-12-15(2)24(23-14)18-6-4-17(5-7-18)8-9-21-16(3)19-13-20-10-11-22-19/h4-7,10-13,16,21H,8-9H2,1-3H3/t16-/m0/s1.
What are the key properties of (1S)-N-[2-[4-(3,5-dimethylpyrazol-1-yl)phenyl]ethyl]-1-pyrazin-2-ylethanamine?
(1S)-N-[2-[4-(3,5-dimethylpyrazol-1-yl)phenyl]ethyl]-1-pyrazin-2-ylethanamine has a molecular weight of 321.43 g/mol, XLogP of 3.17, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-N-[2-[4-(3,5-dimethylpyrazol-1-yl)phenyl]ethyl]-1-pyrazin-2-ylethanamine is sourced from PubChem (CID 97321808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).