C15H28N2O — CID 97322384
(2S)-N-(dicyclopropylmethyl)-2-[(3R)-3-methylmorpholin-4-yl]propan-1-amine (PubChem CID 97322384) has the molecular formula C15H28N2O and a molecular weight of 252.40 g/mol. Its IUPAC name is (2S)-N-(dicyclopropylmethyl)-2-[(3R)-3-methylmorpholin-4-yl]propan-1-amine.
| Compound Name | (2S)-N-(dicyclopropylmethyl)-2-[(3R)-3-methylmorpholin-4-yl]propan-1-amine |
|---|---|
| PubChem CID | 97322384 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | (2S)-N-(dicyclopropylmethyl)-2-[(3R)-3-methylmorpholin-4-yl]propan-1-amine |
| SMILES | C[C@@H]1COCCN1[C@@H](C)CNC(C1CC1)C1CC1 |
| InChI | InChI=1S/C15H28N2O/c1-11(17-7-8-18-10-12(17)2)9-16-15(13-3-4-13)14-5-6-14/h11-16H,3-10H2,1-2H3/t11-,12+/m0/s1 |
| InChIKey | QABMJDGBHGTZNB-NWDGAFQWSA-N |
| XLogP | 1.87 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |