C17H23F3N2 — CID 97323060
(1S,5R)-9-methyl-N-[(1S)-1-(3,4,5-trifluorophenyl)ethyl]-9-azabicyclo[3.3.1]nonan-3-amine (PubChem CID 97323060) has the molecular formula C17H23F3N2 and a molecular weight of 312.38 g/mol. Its IUPAC name is (1S,5R)-9-methyl-N-[(1S)-1-(3,4,5-trifluorophenyl)ethyl]-9-azabicyclo[3.3.1]nonan-3-amine.
| Compound Name | (1S,5R)-9-methyl-N-[(1S)-1-(3,4,5-trifluorophenyl)ethyl]-9-azabicyclo[3.3.1]nonan-3-amine |
|---|---|
| PubChem CID | 97323060 |
| Molecular Formula | C17H23F3N2 |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | (1S,5R)-9-methyl-N-[(1S)-1-(3,4,5-trifluorophenyl)ethyl]-9-azabicyclo[3.3.1]nonan-3-amine |
| SMILES | C[C@H](NC1C[C@H]2CCC[C@@H](C1)N2C)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C17H23F3N2/c1-10(11-6-15(18)17(20)16(19)7-11)21-12-8-13-4-3-5-14(9-12)22(13)2/h6-7,10,12-14,21H,3-5,8-9H2,1-2H3/t10-,12?,13-,14+/m0/s1 |
| InChIKey | JYNUQIGSNKDOBC-HLVVYCRESA-N |
| XLogP | 3.77 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|