C19H23FN2OS — CID 97323540
N-[3-[(1R)-1-[[4-fluoro-2-(methylsulfanylmethyl)phenyl]methylamino]ethyl]phenyl]acetamide (PubChem CID 97323540) has the molecular formula C19H23FN2OS and a molecular weight of 346.47 g/mol. Its IUPAC name is N-[3-[(1R)-1-[[4-fluoro-2-(methylsulfanylmethyl)phenyl]methylamino]ethyl]phenyl]acetamide.
| Compound Name | N-[3-[(1R)-1-[[4-fluoro-2-(methylsulfanylmethyl)phenyl]methylamino]ethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 97323540 |
| Molecular Formula | C19H23FN2OS |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | N-[3-[(1R)-1-[[4-fluoro-2-(methylsulfanylmethyl)phenyl]methylamino]ethyl]phenyl]acetamide |
| SMILES | CSCc1cc(F)ccc1CN[C@H](C)c1cccc(NC(C)=O)c1 |
| InChI | InChI=1S/C19H23FN2OS/c1-13(15-5-4-6-19(10-15)22-14(2)23)21-11-16-7-8-18(20)9-17(16)12-24-3/h4-10,13,21H,11-12H2,1-3H3,(H,22,23)/t13-/m1/s1 |
| InChIKey | WHSFKTQWMMDWNX-CYBMUJFWSA-N |
| XLogP | 4.50 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |