C17H23NO3 — CID 97323660
N-[(1R)-1-(1-benzofuran-2-yl)ethyl]-3-[(3R)-oxolan-3-yl]oxypropan-1-amine (PubChem CID 97323660) has the molecular formula C17H23NO3 and a molecular weight of 289.37 g/mol. Its IUPAC name is N-[(1R)-1-(1-benzofuran-2-yl)ethyl]-3-[(3R)-oxolan-3-yl]oxypropan-1-amine.
| Compound Name | N-[(1R)-1-(1-benzofuran-2-yl)ethyl]-3-[(3R)-oxolan-3-yl]oxypropan-1-amine |
|---|---|
| PubChem CID | 97323660 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | N-[(1R)-1-(1-benzofuran-2-yl)ethyl]-3-[(3R)-oxolan-3-yl]oxypropan-1-amine |
| SMILES | C[C@@H](NCCCO[C@@H]1CCOC1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C17H23NO3/c1-13(17-11-14-5-2-3-6-16(14)21-17)18-8-4-9-20-15-7-10-19-12-15/h2-3,5-6,11,13,15,18H,4,7-10,12H2,1H3/t13-,15-/m1/s1 |
| InChIKey | JXVOGVSWFKZSQG-UKRRQHHQSA-N |
| XLogP | 3.28 |
| TPSA | 43.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|