C18H27N3O — CID 97323663
(1S)-N-[[2-[(2R)-butan-2-yl]oxy-4-methylphenyl]methyl]-1-(1-methylpyrazol-4-yl)ethanamine (PubChem CID 97323663) has the molecular formula C18H27N3O and a molecular weight of 301.43 g/mol. Its IUPAC name is (1S)-N-[[2-[(2R)-butan-2-yl]oxy-4-methylphenyl]methyl]-1-(1-methylpyrazol-4-yl)ethanamine.
| Compound Name | (1S)-N-[[2-[(2R)-butan-2-yl]oxy-4-methylphenyl]methyl]-1-(1-methylpyrazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 97323663 |
| Molecular Formula | C18H27N3O |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.22 |
| IUPAC Name | (1S)-N-[[2-[(2R)-butan-2-yl]oxy-4-methylphenyl]methyl]-1-(1-methylpyrazol-4-yl)ethanamine |
| SMILES | CC[C@@H](C)Oc1cc(C)ccc1CN[C@@H](C)c1cnn(C)c1 |
| InChI | InChI=1S/C18H27N3O/c1-6-14(3)22-18-9-13(2)7-8-16(18)10-19-15(4)17-11-20-21(5)12-17/h7-9,11-12,14-15,19H,6,10H2,1-5H3/t14-,15+/m1/s1 |
| InChIKey | LDTQWKRPCJSWQI-CABCVRRESA-N |
| XLogP | 3.76 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |