C18H25NO5 — CID 97324364
trans-(1S,2S)-2-[[3-(3-methoxypropoxy)benzoyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 97324364) has the molecular formula C18H25NO5 and a molecular weight of 335.40 g/mol. Its IUPAC name is trans-(1S,2S)-2-[[3-(3-methoxypropoxy)benzoyl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | trans-(1S,2S)-2-[[3-(3-methoxypropoxy)benzoyl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 97324364 |
| Molecular Formula | C18H25NO5 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | trans-(1S,2S)-2-[[3-(3-methoxypropoxy)benzoyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | COCCCOc1cccc(C(=O)N[C@H]2CCCC[C@@H]2C(=O)O)c1 |
| InChI | InChI=1S/C18H25NO5/c1-23-10-5-11-24-14-7-4-6-13(12-14)17(20)19-16-9-3-2-8-15(16)18(21)22/h4,6-7,12,15-16H,2-3,5,8-11H2,1H3,(H,19,20)(H,21,22)/t15-,16-/m0/s1 |
| InChIKey | NRGBCYRWWUDCGA-HOTGVXAUSA-N |
| XLogP | 2.48 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|