C17H23N3O2 — CID 97324759
N-[(1R,3R)-2,2-diethyl-3-methoxycyclobutyl]-3H-benzimidazole-5-carboxamide (PubChem CID 97324759) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is N-[(1R,3R)-2,2-diethyl-3-methoxycyclobutyl]-3H-benzimidazole-5-carboxamide.
| Compound Name | N-[(1R,3R)-2,2-diethyl-3-methoxycyclobutyl]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 97324759 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | N-[(1R,3R)-2,2-diethyl-3-methoxycyclobutyl]-3H-benzimidazole-5-carboxamide |
| SMILES | CCC1(CC)[C@H](NC(=O)c2ccc3nc[nH]c3c2)C[C@H]1OC |
| InChI | InChI=1S/C17H23N3O2/c1-4-17(5-2)14(9-15(17)22-3)20-16(21)11-6-7-12-13(8-11)19-10-18-12/h6-8,10,14-15H,4-5,9H2,1-3H3,(H,18,19)(H,20,21)/t14-,15-/m1/s1 |
| InChIKey | QLRDRUGJSMUIBZ-HUUCEWRRSA-N |
| XLogP | 2.89 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |