C18H27NO3 — CID 97326400
(2R)-7-methoxy-N-[2-[[(2R)-oxolan-2-yl]methoxy]ethyl]-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 97326400) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is (2R)-7-methoxy-N-[2-[[(2R)-oxolan-2-yl]methoxy]ethyl]-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | (2R)-7-methoxy-N-[2-[[(2R)-oxolan-2-yl]methoxy]ethyl]-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 97326400 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | (2R)-7-methoxy-N-[2-[[(2R)-oxolan-2-yl]methoxy]ethyl]-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | COc1ccc2c(c1)C[C@H](NCCOC[C@H]1CCCO1)CC2 |
| InChI | InChI=1S/C18H27NO3/c1-20-17-7-5-14-4-6-16(11-15(14)12-17)19-8-10-21-13-18-3-2-9-22-18/h5,7,12,16,18-19H,2-4,6,8-11,13H2,1H3/t16-,18-/m1/s1 |
| InChIKey | ZIODFZMKTBWMGZ-SJLPKXTDSA-N |
| XLogP | 2.34 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|