C15H14Br2N2O2 — CID 97326605
3,5-dibromo-4-hydroxy-N-methyl-N-[(1R)-1-pyridin-4-ylethyl]benzamide (PubChem CID 97326605) has the molecular formula C15H14Br2N2O2 and a molecular weight of 414.10 g/mol. Its IUPAC name is 3,5-dibromo-4-hydroxy-N-methyl-N-[(1R)-1-pyridin-4-ylethyl]benzamide.
| Compound Name | 3,5-dibromo-4-hydroxy-N-methyl-N-[(1R)-1-pyridin-4-ylethyl]benzamide |
|---|---|
| PubChem CID | 97326605 |
| Molecular Formula | C15H14Br2N2O2 |
| Molecular Weight | 414.10 g/mol |
| Exact Mass | 411.94 |
| IUPAC Name | 3,5-dibromo-4-hydroxy-N-methyl-N-[(1R)-1-pyridin-4-ylethyl]benzamide |
| SMILES | C[C@H](c1ccncc1)N(C)C(=O)c1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C15H14Br2N2O2/c1-9(10-3-5-18-6-4-10)19(2)15(21)11-7-12(16)14(20)13(17)8-11/h3-9,20H,1-2H3/t9-/m1/s1 |
| InChIKey | KGFDNQUIKMVEOM-SECBINFHSA-N |
| XLogP | 4.15 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.10 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |