C19H29NO2 — CID 97327792
cis-(1R,2S)-2-[4-(2,5-dimethylphenoxy)piperidin-1-yl]cyclohexan-1-ol (PubChem CID 97327792) has the molecular formula C19H29NO2 and a molecular weight of 303.45 g/mol. Its IUPAC name is cis-(1R,2S)-2-[4-(2,5-dimethylphenoxy)piperidin-1-yl]cyclohexan-1-ol.
| Compound Name | cis-(1R,2S)-2-[4-(2,5-dimethylphenoxy)piperidin-1-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 97327792 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | cis-(1R,2S)-2-[4-(2,5-dimethylphenoxy)piperidin-1-yl]cyclohexan-1-ol |
| SMILES | Cc1ccc(C)c(OC2CCN([C@H]3CCCC[C@H]3O)CC2)c1 |
| InChI | InChI=1S/C19H29NO2/c1-14-7-8-15(2)19(13-14)22-16-9-11-20(12-10-16)17-5-3-4-6-18(17)21/h7-8,13,16-18,21H,3-6,9-12H2,1-2H3/t17-,18+/m0/s1 |
| InChIKey | BZUJULODEPSJMM-ZWKOTPCHSA-N |
| XLogP | 3.45 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |