C18H27N5O2 — CID 97327909
2-methyl-1-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-3-[(1S)-1-[4-(2-methylpropoxy)phenyl]ethyl]guanidine (PubChem CID 97327909) has the molecular formula C18H27N5O2 and a molecular weight of 345.45 g/mol. Its IUPAC name is 2-methyl-1-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-3-[(1S)-1-[4-(2-methylpropoxy)phenyl]ethyl]guanidine.
| Compound Name | 2-methyl-1-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-3-[(1S)-1-[4-(2-methylpropoxy)phenyl]ethyl]guanidine |
|---|---|
| PubChem CID | 97327909 |
| Molecular Formula | C18H27N5O2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | 2-methyl-1-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-3-[(1S)-1-[4-(2-methylpropoxy)phenyl]ethyl]guanidine |
| SMILES | C/N=C(\NCc1noc(C)n1)N[C@@H](C)c1ccc(OCC(C)C)cc1 |
| InChI | InChI=1S/C18H27N5O2/c1-12(2)11-24-16-8-6-15(7-9-16)13(3)21-18(19-5)20-10-17-22-14(4)25-23-17/h6-9,12-13H,10-11H2,1-5H3,(H2,19,20,21)/t13-/m0/s1 |
| InChIKey | LKZCEQPIEADGAT-ZDUSSCGKSA-N |
| XLogP | 2.84 |
| TPSA | 84.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|