C19H25NO — CID 97328250
(1S,5S,6R)-N-[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-amine (PubChem CID 97328250) has the molecular formula C19H25NO and a molecular weight of 283.41 g/mol. Its IUPAC name is (1S,5S,6R)-N-[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-amine.
| Compound Name | (1S,5S,6R)-N-[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-amine |
|---|---|
| PubChem CID | 97328250 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | (1S,5S,6R)-N-[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclobutane]-6-amine |
| SMILES | c1ccc2c(c1)CC[C@H](N[C@@H]1[C@@H]3CCO[C@@H]3C13CCC3)C2 |
| InChI | InChI=1S/C19H25NO/c1-2-5-14-12-15(7-6-13(14)4-1)20-17-16-8-11-21-18(16)19(17)9-3-10-19/h1-2,4-5,15-18,20H,3,6-12H2/t15-,16-,17+,18-/m0/s1 |
| InChIKey | XZOVXEARMQFIAA-FJIDUMEYSA-N |
| XLogP | 3.09 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |