C17H17F2N3O2 — CID 97328708
1-[(2S)-1-(3,5-dimethyl-1,2-oxazol-4-yl)propan-2-yl]-3-(4-ethynyl-2,6-difluorophenyl)urea (PubChem CID 97328708) has the molecular formula C17H17F2N3O2 and a molecular weight of 333.34 g/mol. Its IUPAC name is 1-[(2S)-1-(3,5-dimethyl-1,2-oxazol-4-yl)propan-2-yl]-3-(4-ethynyl-2,6-difluorophenyl)urea.
| Compound Name | 1-[(2S)-1-(3,5-dimethyl-1,2-oxazol-4-yl)propan-2-yl]-3-(4-ethynyl-2,6-difluorophenyl)urea |
|---|---|
| PubChem CID | 97328708 |
| Molecular Formula | C17H17F2N3O2 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 1-[(2S)-1-(3,5-dimethyl-1,2-oxazol-4-yl)propan-2-yl]-3-(4-ethynyl-2,6-difluorophenyl)urea |
| SMILES | C#Cc1cc(F)c(NC(=O)N[C@@H](C)Cc2c(C)noc2C)c(F)c1 |
| InChI | InChI=1S/C17H17F2N3O2/c1-5-12-7-14(18)16(15(19)8-12)21-17(23)20-9(2)6-13-10(3)22-24-11(13)4/h1,7-9H,6H2,2-4H3,(H2,20,21,23)/t9-/m0/s1 |
| InChIKey | NHCUSJVCKCSTCS-VIFPVBQESA-N |
| XLogP | 3.30 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|