C15H22N2O3S — CID 97329133
tert-butyl 2-[(2S)-2-thiophen-2-ylpropanoyl]pyrazolidine-1-carboxylate (PubChem CID 97329133) has the molecular formula C15H22N2O3S and a molecular weight of 310.42 g/mol. Its IUPAC name is tert-butyl 2-[(2S)-2-thiophen-2-ylpropanoyl]pyrazolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[(2S)-2-thiophen-2-ylpropanoyl]pyrazolidine-1-carboxylate |
|---|---|
| PubChem CID | 97329133 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | tert-butyl 2-[(2S)-2-thiophen-2-ylpropanoyl]pyrazolidine-1-carboxylate |
| SMILES | C[C@@H](C(=O)N1CCCN1C(=O)OC(C)(C)C)c1cccs1 |
| InChI | InChI=1S/C15H22N2O3S/c1-11(12-7-5-10-21-12)13(18)16-8-6-9-17(16)14(19)20-15(2,3)4/h5,7,10-11H,6,8-9H2,1-4H3/t11-/m1/s1 |
| InChIKey | QVBNOQWLJQAFGM-LLVKDONJSA-N |
| XLogP | 3.24 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |