C16H13ClFN3O2 — CID 97329341
N-[(3R)-1-(4-chloro-3-fluorophenyl)-2-oxopyrrolidin-3-yl]pyridine-4-carboxamide (PubChem CID 97329341) has the molecular formula C16H13ClFN3O2 and a molecular weight of 333.75 g/mol. Its IUPAC name is N-[(3R)-1-(4-chloro-3-fluorophenyl)-2-oxopyrrolidin-3-yl]pyridine-4-carboxamide.
| Compound Name | N-[(3R)-1-(4-chloro-3-fluorophenyl)-2-oxopyrrolidin-3-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 97329341 |
| Molecular Formula | C16H13ClFN3O2 |
| Molecular Weight | 333.75 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | N-[(3R)-1-(4-chloro-3-fluorophenyl)-2-oxopyrrolidin-3-yl]pyridine-4-carboxamide |
| SMILES | O=C(N[C@@H]1CCN(c2ccc(Cl)c(F)c2)C1=O)c1ccncc1 |
| InChI | InChI=1S/C16H13ClFN3O2/c17-12-2-1-11(9-13(12)18)21-8-5-14(16(21)23)20-15(22)10-3-6-19-7-4-10/h1-4,6-7,9,14H,5,8H2,(H,20,22)/t14-/m1/s1 |
| InChIKey | HKVWXVYDKCPJLJ-CQSZACIVSA-N |
| XLogP | 2.41 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.75 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |