C15H21NO3 — CID 97330210
(2R)-2-hydroxy-1-[(2R)-2-(2-hydroxypropan-2-yl)pyrrolidin-1-yl]-2-phenylethanone (PubChem CID 97330210) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is (2R)-2-hydroxy-1-[(2R)-2-(2-hydroxypropan-2-yl)pyrrolidin-1-yl]-2-phenylethanone.
| Compound Name | (2R)-2-hydroxy-1-[(2R)-2-(2-hydroxypropan-2-yl)pyrrolidin-1-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 97330210 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | (2R)-2-hydroxy-1-[(2R)-2-(2-hydroxypropan-2-yl)pyrrolidin-1-yl]-2-phenylethanone |
| SMILES | CC(C)(O)[C@H]1CCCN1C(=O)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C15H21NO3/c1-15(2,19)12-9-6-10-16(12)14(18)13(17)11-7-4-3-5-8-11/h3-5,7-8,12-13,17,19H,6,9-10H2,1-2H3/t12-,13-/m1/s1 |
| InChIKey | UTRBJCAHGCZXTB-CHWSQXEVSA-N |
| XLogP | 1.48 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |