About (3R)-3-(3,5-dimethyl-1H-pyrazol-4-yl)-4-(2-fluorophenyl)sulfonylmorpholine
(3R)-3-(3,5-dimethyl-1H-pyrazol-4-yl)-4-(2-fluorophenyl)sulfonylmorpholine (PubChem CID 97330629) has the molecular formula C15H18FN3O3S
and a molecular weight of 339.39 g/mol. Its IUPAC name is (3R)-3-(3,5-dimethyl-1H-pyrazol-4-yl)-4-(2-fluorophenyl)sulfonylmorpholine.
Molecular Properties
| Compound Name | (3R)-3-(3,5-dimethyl-1H-pyrazol-4-yl)-4-(2-fluorophenyl)sulfonylmorpholine |
| PubChem CID | 97330629 |
| Molecular Formula | C15H18FN3O3S |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | (3R)-3-(3,5-dimethyl-1H-pyrazol-4-yl)-4-(2-fluorophenyl)sulfonylmorpholine |
| SMILES | Cc1n[nH]c(C)c1[C@@H]1COCCN1S(=O)(=O)c1ccccc1F |
| InChI | InChI=1S/C15H18FN3O3S/c1-10-15(11(2)18-17-10)13-9-22-8-7-19(13)23(20,21)14-6-4-3-5-12(14)16/h3-6,13H,7-9H2,1-2H3,(H,17,18)/t13-/m0/s1 |
| InChIKey | HKNAQBKEIPGLOA-ZDUSSCGKSA-N |
| XLogP | 1.93 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3R)-3-(3,5-dimethyl-1H-pyrazol-4-yl)-4-(2-fluorophenyl)sulfonylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-(3,5-dimethyl-1H-pyrazol-4-yl)-4-(2-fluorophenyl)sulfonylmorpholine?
The IUPAC name of (3R)-3-(3,5-dimethyl-1H-pyrazol-4-yl)-4-(2-fluorophenyl)sulfonylmorpholine (CID 97330629) is (3R)-3-(3,5-dimethyl-1H-pyrazol-4-yl)-4-(2-fluorophenyl)sulfonylmorpholine.
What is the SMILES notation for (3R)-3-(3,5-dimethyl-1H-pyrazol-4-yl)-4-(2-fluorophenyl)sulfonylmorpholine?
The canonical SMILES for (3R)-3-(3,5-dimethyl-1H-pyrazol-4-yl)-4-(2-fluorophenyl)sulfonylmorpholine is Cc1n[nH]c(C)c1[C@@H]1COCCN1S(=O)(=O)c1ccccc1F.
What is the InChIKey of (3R)-3-(3,5-dimethyl-1H-pyrazol-4-yl)-4-(2-fluorophenyl)sulfonylmorpholine?
The InChIKey is HKNAQBKEIPGLOA-ZDUSSCGKSA-N. The full InChI is InChI=1S/C15H18FN3O3S/c1-10-15(11(2)18-17-10)13-9-22-8-7-19(13)23(20,21)14-6-4-3-5-12(14)16/h3-6,13H,7-9H2,1-2H3,(H,17,18)/t13-/m0/s1.
What are the key properties of (3R)-3-(3,5-dimethyl-1H-pyrazol-4-yl)-4-(2-fluorophenyl)sulfonylmorpholine?
(3R)-3-(3,5-dimethyl-1H-pyrazol-4-yl)-4-(2-fluorophenyl)sulfonylmorpholine has a molecular weight of 339.39 g/mol, XLogP of 1.93, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-(3,5-dimethyl-1H-pyrazol-4-yl)-4-(2-fluorophenyl)sulfonylmorpholine is sourced from PubChem (CID 97330629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).