C16H24ClNOS — CID 97332983
4-(4-chlorophenyl)sulfanyl-N-[(2R)-1-methoxypropan-2-yl]cyclohexan-1-amine (PubChem CID 97332983) has the molecular formula C16H24ClNOS and a molecular weight of 313.89 g/mol. Its IUPAC name is 4-(4-chlorophenyl)sulfanyl-N-[(2R)-1-methoxypropan-2-yl]cyclohexan-1-amine.
| Compound Name | 4-(4-chlorophenyl)sulfanyl-N-[(2R)-1-methoxypropan-2-yl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 97332983 |
| Molecular Formula | C16H24ClNOS |
| Molecular Weight | 313.89 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 4-(4-chlorophenyl)sulfanyl-N-[(2R)-1-methoxypropan-2-yl]cyclohexan-1-amine |
| SMILES | COC[C@@H](C)NC1CCC(Sc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C16H24ClNOS/c1-12(11-19-2)18-14-5-9-16(10-6-14)20-15-7-3-13(17)4-8-15/h3-4,7-8,12,14,16,18H,5-6,9-11H2,1-2H3/t12-,14?,16?/m1/s1 |
| InChIKey | VOVFFWMNIQQVDD-XEBKBJJBSA-N |
| XLogP | 4.37 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.89 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |