C17H22N8O2S — CID 97333148
(2S)-1-[[1-(4-methylsulfonylphenyl)tetrazol-5-yl]methyl]-2-(triazol-1-ylmethyl)piperidine (PubChem CID 97333148) has the molecular formula C17H22N8O2S and a molecular weight of 402.48 g/mol. Its IUPAC name is (2S)-1-[[1-(4-methylsulfonylphenyl)tetrazol-5-yl]methyl]-2-(triazol-1-ylmethyl)piperidine.
| Compound Name | (2S)-1-[[1-(4-methylsulfonylphenyl)tetrazol-5-yl]methyl]-2-(triazol-1-ylmethyl)piperidine |
|---|---|
| PubChem CID | 97333148 |
| Molecular Formula | C17H22N8O2S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | (2S)-1-[[1-(4-methylsulfonylphenyl)tetrazol-5-yl]methyl]-2-(triazol-1-ylmethyl)piperidine |
| SMILES | CS(=O)(=O)c1ccc(-n2nnnc2CN2CCCC[C@H]2Cn2ccnn2)cc1 |
| InChI | InChI=1S/C17H22N8O2S/c1-28(26,27)16-7-5-14(6-8-16)25-17(19-20-22-25)13-23-10-3-2-4-15(23)12-24-11-9-18-21-24/h5-9,11,15H,2-4,10,12-13H2,1H3/t15-/m0/s1 |
| InChIKey | JCVFMBWYLBCRMS-HNNXBMFYSA-N |
| XLogP | 0.71 |
| TPSA | 111.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |