About 4-hydroxy-N-[(2R,3R)-2-methyloxolan-3-yl]-4-(trifluoromethyl)piperidine-1-carboxamide
4-hydroxy-N-[(2R,3R)-2-methyloxolan-3-yl]-4-(trifluoromethyl)piperidine-1-carboxamide (PubChem CID 97334298) has the molecular formula C12H19F3N2O3
and a molecular weight of 296.29 g/mol. Its IUPAC name is 4-hydroxy-N-[(2R,3R)-2-methyloxolan-3-yl]-4-(trifluoromethyl)piperidine-1-carboxamide.
Molecular Properties
| Compound Name | 4-hydroxy-N-[(2R,3R)-2-methyloxolan-3-yl]-4-(trifluoromethyl)piperidine-1-carboxamide |
| PubChem CID | 97334298 |
| Molecular Formula | C12H19F3N2O3 |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 4-hydroxy-N-[(2R,3R)-2-methyloxolan-3-yl]-4-(trifluoromethyl)piperidine-1-carboxamide |
| SMILES | C[C@H]1OCC[C@H]1NC(=O)N1CCC(O)(C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H19F3N2O3/c1-8-9(2-7-20-8)16-10(18)17-5-3-11(19,4-6-17)12(13,14)15/h8-9,19H,2-7H2,1H3,(H,16,18)/t8-,9-/m1/s1 |
| InChIKey | WFOIGZFGPHFGSP-RKDXNWHRSA-N |
| XLogP | 1.26 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-hydroxy-N-[(2R,3R)-2-methyloxolan-3-yl]-4-(trifluoromethyl)piperidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-N-[(2R,3R)-2-methyloxolan-3-yl]-4-(trifluoromethyl)piperidine-1-carboxamide?
The IUPAC name of 4-hydroxy-N-[(2R,3R)-2-methyloxolan-3-yl]-4-(trifluoromethyl)piperidine-1-carboxamide (CID 97334298) is 4-hydroxy-N-[(2R,3R)-2-methyloxolan-3-yl]-4-(trifluoromethyl)piperidine-1-carboxamide.
What is the SMILES notation for 4-hydroxy-N-[(2R,3R)-2-methyloxolan-3-yl]-4-(trifluoromethyl)piperidine-1-carboxamide?
The canonical SMILES for 4-hydroxy-N-[(2R,3R)-2-methyloxolan-3-yl]-4-(trifluoromethyl)piperidine-1-carboxamide is C[C@H]1OCC[C@H]1NC(=O)N1CCC(O)(C(F)(F)F)CC1.
What is the InChIKey of 4-hydroxy-N-[(2R,3R)-2-methyloxolan-3-yl]-4-(trifluoromethyl)piperidine-1-carboxamide?
The InChIKey is WFOIGZFGPHFGSP-RKDXNWHRSA-N. The full InChI is InChI=1S/C12H19F3N2O3/c1-8-9(2-7-20-8)16-10(18)17-5-3-11(19,4-6-17)12(13,14)15/h8-9,19H,2-7H2,1H3,(H,16,18)/t8-,9-/m1/s1.
What are the key properties of 4-hydroxy-N-[(2R,3R)-2-methyloxolan-3-yl]-4-(trifluoromethyl)piperidine-1-carboxamide?
4-hydroxy-N-[(2R,3R)-2-methyloxolan-3-yl]-4-(trifluoromethyl)piperidine-1-carboxamide has a molecular weight of 296.29 g/mol, XLogP of 1.26, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-N-[(2R,3R)-2-methyloxolan-3-yl]-4-(trifluoromethyl)piperidine-1-carboxamide is sourced from PubChem (CID 97334298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).