C16H21N3O5 — CID 97334645
N-(2,6-dimethyl-3-nitrophenyl)-N'-[(1S)-1-[(2R)-oxolan-2-yl]ethyl]oxamide (PubChem CID 97334645) has the molecular formula C16H21N3O5 and a molecular weight of 335.36 g/mol. Its IUPAC name is N-(2,6-dimethyl-3-nitrophenyl)-N'-[(1S)-1-[(2R)-oxolan-2-yl]ethyl]oxamide.
| Compound Name | N-(2,6-dimethyl-3-nitrophenyl)-N'-[(1S)-1-[(2R)-oxolan-2-yl]ethyl]oxamide |
|---|---|
| PubChem CID | 97334645 |
| Molecular Formula | C16H21N3O5 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | N-(2,6-dimethyl-3-nitrophenyl)-N'-[(1S)-1-[(2R)-oxolan-2-yl]ethyl]oxamide |
| SMILES | Cc1ccc([N+](=O)[O-])c(C)c1NC(=O)C(=O)N[C@@H](C)[C@H]1CCCO1 |
| InChI | InChI=1S/C16H21N3O5/c1-9-6-7-12(19(22)23)10(2)14(9)18-16(21)15(20)17-11(3)13-5-4-8-24-13/h6-7,11,13H,4-5,8H2,1-3H3,(H,17,20)(H,18,21)/t11-,13+/m0/s1 |
| InChIKey | NEVBOEPJGDXOHT-WCQYABFASA-N |
| XLogP | 1.83 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|