C22H27N3O4 — CID 97334916
methyl 3-[(3S)-3-methyl-4-[4-(pyridin-2-ylmethoxy)benzoyl]piperazin-1-yl]propanoate (PubChem CID 97334916) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is methyl 3-[(3S)-3-methyl-4-[4-(pyridin-2-ylmethoxy)benzoyl]piperazin-1-yl]propanoate.
| Compound Name | methyl 3-[(3S)-3-methyl-4-[4-(pyridin-2-ylmethoxy)benzoyl]piperazin-1-yl]propanoate |
|---|---|
| PubChem CID | 97334916 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | methyl 3-[(3S)-3-methyl-4-[4-(pyridin-2-ylmethoxy)benzoyl]piperazin-1-yl]propanoate |
| SMILES | COC(=O)CCN1CCN(C(=O)c2ccc(OCc3ccccn3)cc2)[C@@H](C)C1 |
| InChI | InChI=1S/C22H27N3O4/c1-17-15-24(12-10-21(26)28-2)13-14-25(17)22(27)18-6-8-20(9-7-18)29-16-19-5-3-4-11-23-19/h3-9,11,17H,10,12-16H2,1-2H3/t17-/m0/s1 |
| InChIKey | SAHZFUZKAPIGFA-KRWDZBQOSA-N |
| XLogP | 2.37 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |