C16H25NO3 — CID 97335375
methyl 5-[(3aS,7aS)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-3,3-dimethyl-5-oxopentanoate (PubChem CID 97335375) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is methyl 5-[(3aS,7aS)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-3,3-dimethyl-5-oxopentanoate.
| Compound Name | methyl 5-[(3aS,7aS)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-3,3-dimethyl-5-oxopentanoate |
|---|---|
| PubChem CID | 97335375 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | methyl 5-[(3aS,7aS)-1,3,3a,4,7,7a-hexahydroisoindol-2-yl]-3,3-dimethyl-5-oxopentanoate |
| SMILES | COC(=O)CC(C)(C)CC(=O)N1C[C@H]2CC=CC[C@@H]2C1 |
| InChI | InChI=1S/C16H25NO3/c1-16(2,9-15(19)20-3)8-14(18)17-10-12-6-4-5-7-13(12)11-17/h4-5,12-13H,6-11H2,1-3H3/t12-,13-/m1/s1 |
| InChIKey | QEFORMFQITWRJO-CHWSQXEVSA-N |
| XLogP | 2.39 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|