About 3-[[[(1S,3S)-3-ethoxyspiro[3.3]heptan-1-yl]amino]methyl]-N-methylbenzenesulfonamide
3-[[[(1S,3S)-3-ethoxyspiro[3.3]heptan-1-yl]amino]methyl]-N-methylbenzenesulfonamide (PubChem CID 97336126) has the molecular formula C17H26N2O3S
and a molecular weight of 338.47 g/mol. Its IUPAC name is 3-[[[(1S,3S)-3-ethoxyspiro[3.3]heptan-1-yl]amino]methyl]-N-methylbenzenesulfonamide.
Molecular Properties
| Compound Name | 3-[[[(1S,3S)-3-ethoxyspiro[3.3]heptan-1-yl]amino]methyl]-N-methylbenzenesulfonamide |
| PubChem CID | 97336126 |
| Molecular Formula | C17H26N2O3S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 3-[[[(1S,3S)-3-ethoxyspiro[3.3]heptan-1-yl]amino]methyl]-N-methylbenzenesulfonamide |
| SMILES | CCO[C@H]1C[C@H](NCc2cccc(S(=O)(=O)NC)c2)C12CCC2 |
| InChI | InChI=1S/C17H26N2O3S/c1-3-22-16-11-15(17(16)8-5-9-17)19-12-13-6-4-7-14(10-13)23(20,21)18-2/h4,6-7,10,15-16,18-19H,3,5,8-9,11-12H2,1-2H3/t15-,16-/m0/s1 |
| InChIKey | AJXXUHPHHZSREO-HOTGVXAUSA-N |
| XLogP | 2.03 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[[[(1S,3S)-3-ethoxyspiro[3.3]heptan-1-yl]amino]methyl]-N-methylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[[(1S,3S)-3-ethoxyspiro[3.3]heptan-1-yl]amino]methyl]-N-methylbenzenesulfonamide?
The IUPAC name of 3-[[[(1S,3S)-3-ethoxyspiro[3.3]heptan-1-yl]amino]methyl]-N-methylbenzenesulfonamide (CID 97336126) is 3-[[[(1S,3S)-3-ethoxyspiro[3.3]heptan-1-yl]amino]methyl]-N-methylbenzenesulfonamide.
What is the SMILES notation for 3-[[[(1S,3S)-3-ethoxyspiro[3.3]heptan-1-yl]amino]methyl]-N-methylbenzenesulfonamide?
The canonical SMILES for 3-[[[(1S,3S)-3-ethoxyspiro[3.3]heptan-1-yl]amino]methyl]-N-methylbenzenesulfonamide is CCO[C@H]1C[C@H](NCc2cccc(S(=O)(=O)NC)c2)C12CCC2.
What is the InChIKey of 3-[[[(1S,3S)-3-ethoxyspiro[3.3]heptan-1-yl]amino]methyl]-N-methylbenzenesulfonamide?
The InChIKey is AJXXUHPHHZSREO-HOTGVXAUSA-N. The full InChI is InChI=1S/C17H26N2O3S/c1-3-22-16-11-15(17(16)8-5-9-17)19-12-13-6-4-7-14(10-13)23(20,21)18-2/h4,6-7,10,15-16,18-19H,3,5,8-9,11-12H2,1-2H3/t15-,16-/m0/s1.
What are the key properties of 3-[[[(1S,3S)-3-ethoxyspiro[3.3]heptan-1-yl]amino]methyl]-N-methylbenzenesulfonamide?
3-[[[(1S,3S)-3-ethoxyspiro[3.3]heptan-1-yl]amino]methyl]-N-methylbenzenesulfonamide has a molecular weight of 338.47 g/mol, XLogP of 2.03, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[[(1S,3S)-3-ethoxyspiro[3.3]heptan-1-yl]amino]methyl]-N-methylbenzenesulfonamide is sourced from PubChem (CID 97336126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).