C15H15F2NO2 — CID 97336723
(2R,3S)-2-(3,4-difluorophenyl)-N-(furan-2-ylmethyl)oxolan-3-amine (PubChem CID 97336723) has the molecular formula C15H15F2NO2 and a molecular weight of 279.29 g/mol. Its IUPAC name is (2R,3S)-2-(3,4-difluorophenyl)-N-(furan-2-ylmethyl)oxolan-3-amine.
| Compound Name | (2R,3S)-2-(3,4-difluorophenyl)-N-(furan-2-ylmethyl)oxolan-3-amine |
|---|---|
| PubChem CID | 97336723 |
| Molecular Formula | C15H15F2NO2 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | (2R,3S)-2-(3,4-difluorophenyl)-N-(furan-2-ylmethyl)oxolan-3-amine |
| SMILES | Fc1ccc([C@H]2OCC[C@@H]2NCc2ccco2)cc1F |
| InChI | InChI=1S/C15H15F2NO2/c16-12-4-3-10(8-13(12)17)15-14(5-7-20-15)18-9-11-2-1-6-19-11/h1-4,6,8,14-15,18H,5,7,9H2/t14-,15+/m0/s1 |
| InChIKey | MJRNPBAVZQHANV-LSDHHAIUSA-N |
| XLogP | 3.18 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |