C16H17ClFN3O2 — CID 97337062
(2S,3S)-2-(4-chloro-3-fluorophenyl)-N-(cyanomethyl)-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide (PubChem CID 97337062) has the molecular formula C16H17ClFN3O2 and a molecular weight of 337.78 g/mol. Its IUPAC name is (2S,3S)-2-(4-chloro-3-fluorophenyl)-N-(cyanomethyl)-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide.
| Compound Name | (2S,3S)-2-(4-chloro-3-fluorophenyl)-N-(cyanomethyl)-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 97337062 |
| Molecular Formula | C16H17ClFN3O2 |
| Molecular Weight | 337.78 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | (2S,3S)-2-(4-chloro-3-fluorophenyl)-N-(cyanomethyl)-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide |
| SMILES | CC(C)N1C(=O)C[C@H](C(=O)NCC#N)[C@H]1c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C16H17ClFN3O2/c1-9(2)21-14(22)8-11(16(23)20-6-5-19)15(21)10-3-4-12(17)13(18)7-10/h3-4,7,9,11,15H,6,8H2,1-2H3,(H,20,23)/t11-,15+/m0/s1 |
| InChIKey | KXSOESDXKXQMIA-XHDPSFHLSA-N |
| XLogP | 2.42 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.78 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|