About 5-[[[(3R)-1,4,8-trioxaspiro[4.5]decan-3-yl]methylamino]methyl]furan-2-carbonitrile
5-[[[(3R)-1,4,8-trioxaspiro[4.5]decan-3-yl]methylamino]methyl]furan-2-carbonitrile (PubChem CID 97338209) has the molecular formula C14H18N2O4
and a molecular weight of 278.31 g/mol. Its IUPAC name is 5-[[[(3R)-1,4,8-trioxaspiro[4.5]decan-3-yl]methylamino]methyl]furan-2-carbonitrile.
Molecular Properties
| Compound Name | 5-[[[(3R)-1,4,8-trioxaspiro[4.5]decan-3-yl]methylamino]methyl]furan-2-carbonitrile |
| PubChem CID | 97338209 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 5-[[[(3R)-1,4,8-trioxaspiro[4.5]decan-3-yl]methylamino]methyl]furan-2-carbonitrile |
| SMILES | N#Cc1ccc(CNC[C@@H]2COC3(CCOCC3)O2)o1 |
| InChI | InChI=1S/C14H18N2O4/c15-7-11-1-2-12(19-11)8-16-9-13-10-18-14(20-13)3-5-17-6-4-14/h1-2,13,16H,3-6,8-10H2/t13-/m1/s1 |
| InChIKey | IHEWMRJOZKDMAI-CYBMUJFWSA-N |
| XLogP | 1.16 |
| TPSA | 76.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[[[(3R)-1,4,8-trioxaspiro[4.5]decan-3-yl]methylamino]methyl]furan-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[[(3R)-1,4,8-trioxaspiro[4.5]decan-3-yl]methylamino]methyl]furan-2-carbonitrile?
The IUPAC name of 5-[[[(3R)-1,4,8-trioxaspiro[4.5]decan-3-yl]methylamino]methyl]furan-2-carbonitrile (CID 97338209) is 5-[[[(3R)-1,4,8-trioxaspiro[4.5]decan-3-yl]methylamino]methyl]furan-2-carbonitrile.
What is the SMILES notation for 5-[[[(3R)-1,4,8-trioxaspiro[4.5]decan-3-yl]methylamino]methyl]furan-2-carbonitrile?
The canonical SMILES for 5-[[[(3R)-1,4,8-trioxaspiro[4.5]decan-3-yl]methylamino]methyl]furan-2-carbonitrile is N#Cc1ccc(CNC[C@@H]2COC3(CCOCC3)O2)o1.
What is the InChIKey of 5-[[[(3R)-1,4,8-trioxaspiro[4.5]decan-3-yl]methylamino]methyl]furan-2-carbonitrile?
The InChIKey is IHEWMRJOZKDMAI-CYBMUJFWSA-N. The full InChI is InChI=1S/C14H18N2O4/c15-7-11-1-2-12(19-11)8-16-9-13-10-18-14(20-13)3-5-17-6-4-14/h1-2,13,16H,3-6,8-10H2/t13-/m1/s1.
What are the key properties of 5-[[[(3R)-1,4,8-trioxaspiro[4.5]decan-3-yl]methylamino]methyl]furan-2-carbonitrile?
5-[[[(3R)-1,4,8-trioxaspiro[4.5]decan-3-yl]methylamino]methyl]furan-2-carbonitrile has a molecular weight of 278.31 g/mol, XLogP of 1.16, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[[(3R)-1,4,8-trioxaspiro[4.5]decan-3-yl]methylamino]methyl]furan-2-carbonitrile is sourced from PubChem (CID 97338209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).