C15H19F2N3O — CID 97338534
N-[(2R)-1-(3,4-difluorophenoxy)propan-2-yl]-1-propylpyrazol-4-amine (PubChem CID 97338534) has the molecular formula C15H19F2N3O and a molecular weight of 295.33 g/mol. Its IUPAC name is N-[(2R)-1-(3,4-difluorophenoxy)propan-2-yl]-1-propylpyrazol-4-amine.
| Compound Name | N-[(2R)-1-(3,4-difluorophenoxy)propan-2-yl]-1-propylpyrazol-4-amine |
|---|---|
| PubChem CID | 97338534 |
| Molecular Formula | C15H19F2N3O |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | N-[(2R)-1-(3,4-difluorophenoxy)propan-2-yl]-1-propylpyrazol-4-amine |
| SMILES | CCCn1cc(N[C@H](C)COc2ccc(F)c(F)c2)cn1 |
| InChI | InChI=1S/C15H19F2N3O/c1-3-6-20-9-12(8-18-20)19-11(2)10-21-13-4-5-14(16)15(17)7-13/h4-5,7-9,11,19H,3,6,10H2,1-2H3/t11-/m1/s1 |
| InChIKey | SCHJNWIDTUVSHX-LLVKDONJSA-N |
| XLogP | 3.45 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |