C23H28N2O5 — CID 97338752
(2R)-2-[[1-(4-methoxynaphthalene-1-carbonyl)piperidine-4-carbonyl]amino]pentanoic acid (PubChem CID 97338752) has the molecular formula C23H28N2O5 and a molecular weight of 412.49 g/mol. Its IUPAC name is (2R)-2-[[1-(4-methoxynaphthalene-1-carbonyl)piperidine-4-carbonyl]amino]pentanoic acid.
| Compound Name | (2R)-2-[[1-(4-methoxynaphthalene-1-carbonyl)piperidine-4-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 97338752 |
| Molecular Formula | C23H28N2O5 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | (2R)-2-[[1-(4-methoxynaphthalene-1-carbonyl)piperidine-4-carbonyl]amino]pentanoic acid |
| SMILES | CCC[C@@H](NC(=O)C1CCN(C(=O)c2ccc(OC)c3ccccc23)CC1)C(=O)O |
| InChI | InChI=1S/C23H28N2O5/c1-3-6-19(23(28)29)24-21(26)15-11-13-25(14-12-15)22(27)18-9-10-20(30-2)17-8-5-4-7-16(17)18/h4-5,7-10,15,19H,3,6,11-14H2,1-2H3,(H,24,26)(H,28,29)/t19-/m1/s1 |
| InChIKey | FNCCQQHRJUPGGY-LJQANCHMSA-N |
| XLogP | 3.07 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |