C19H23NO5 — CID 97338925
3-[(2R)-1-[2-(6-methoxy-1-benzofuran-3-yl)acetyl]piperidin-2-yl]propanoic acid (PubChem CID 97338925) has the molecular formula C19H23NO5 and a molecular weight of 345.39 g/mol. Its IUPAC name is 3-[(2R)-1-[2-(6-methoxy-1-benzofuran-3-yl)acetyl]piperidin-2-yl]propanoic acid.
| Compound Name | 3-[(2R)-1-[2-(6-methoxy-1-benzofuran-3-yl)acetyl]piperidin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 97338925 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 3-[(2R)-1-[2-(6-methoxy-1-benzofuran-3-yl)acetyl]piperidin-2-yl]propanoic acid |
| SMILES | COc1ccc2c(CC(=O)N3CCCC[C@@H]3CCC(=O)O)coc2c1 |
| InChI | InChI=1S/C19H23NO5/c1-24-15-6-7-16-13(12-25-17(16)11-15)10-18(21)20-9-3-2-4-14(20)5-8-19(22)23/h6-7,11-12,14H,2-5,8-10H2,1H3,(H,22,23)/t14-/m1/s1 |
| InChIKey | KEJKXARZXRFIDN-CQSZACIVSA-N |
| XLogP | 3.23 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |