C21H32N6O — CID 97339653
(7R)-3-cyclohexyl-N-[2-(3-propan-2-yl-1,2,4-triazol-4-yl)ethyl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-7-carboxamide (PubChem CID 97339653) has the molecular formula C21H32N6O and a molecular weight of 384.53 g/mol. Its IUPAC name is (7R)-3-cyclohexyl-N-[2-(3-propan-2-yl-1,2,4-triazol-4-yl)ethyl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-7-carboxamide.
| Compound Name | (7R)-3-cyclohexyl-N-[2-(3-propan-2-yl-1,2,4-triazol-4-yl)ethyl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 97339653 |
| Molecular Formula | C21H32N6O |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.26 |
| IUPAC Name | (7R)-3-cyclohexyl-N-[2-(3-propan-2-yl-1,2,4-triazol-4-yl)ethyl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-7-carboxamide |
| SMILES | CC(C)c1nncn1CCNC(=O)[C@@H]1CCn2c(cnc2C2CCCCC2)C1 |
| InChI | InChI=1S/C21H32N6O/c1-15(2)19-25-24-14-26(19)11-9-22-21(28)17-8-10-27-18(12-17)13-23-20(27)16-6-4-3-5-7-16/h13-17H,3-12H2,1-2H3,(H,22,28)/t17-/m1/s1 |
| InChIKey | UWKKVHRQXJEPLZ-QGZVFWFLSA-N |
| XLogP | 3.02 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |