C22H31N3O2 — CID 97340056
3-ethyl-2-methyl-N-[(2R)-2-morpholin-4-yl-2-[(3R)-oxolan-3-yl]ethyl]quinolin-4-amine (PubChem CID 97340056) has the molecular formula C22H31N3O2 and a molecular weight of 369.51 g/mol. Its IUPAC name is 3-ethyl-2-methyl-N-[(2R)-2-morpholin-4-yl-2-[(3R)-oxolan-3-yl]ethyl]quinolin-4-amine.
| Compound Name | 3-ethyl-2-methyl-N-[(2R)-2-morpholin-4-yl-2-[(3R)-oxolan-3-yl]ethyl]quinolin-4-amine |
|---|---|
| PubChem CID | 97340056 |
| Molecular Formula | C22H31N3O2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | 3-ethyl-2-methyl-N-[(2R)-2-morpholin-4-yl-2-[(3R)-oxolan-3-yl]ethyl]quinolin-4-amine |
| SMILES | CCc1c(C)nc2ccccc2c1NC[C@@H]([C@H]1CCOC1)N1CCOCC1 |
| InChI | InChI=1S/C22H31N3O2/c1-3-18-16(2)24-20-7-5-4-6-19(20)22(18)23-14-21(17-8-11-27-15-17)25-9-12-26-13-10-25/h4-7,17,21H,3,8-15H2,1-2H3,(H,23,24)/t17-,21-/m0/s1 |
| InChIKey | CTUXOIVAZYWRGS-UWJYYQICSA-N |
| XLogP | 3.25 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |