C15H17F3N2O4 — CID 97340103
(5R)-5-(methoxymethyl)-5-methyl-3-[2-[3-(trifluoromethoxy)phenyl]ethyl]imidazolidine-2,4-dione (PubChem CID 97340103) has the molecular formula C15H17F3N2O4 and a molecular weight of 346.31 g/mol. Its IUPAC name is (5R)-5-(methoxymethyl)-5-methyl-3-[2-[3-(trifluoromethoxy)phenyl]ethyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-(methoxymethyl)-5-methyl-3-[2-[3-(trifluoromethoxy)phenyl]ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 97340103 |
| Molecular Formula | C15H17F3N2O4 |
| Molecular Weight | 346.31 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | (5R)-5-(methoxymethyl)-5-methyl-3-[2-[3-(trifluoromethoxy)phenyl]ethyl]imidazolidine-2,4-dione |
| SMILES | COC[C@@]1(C)NC(=O)N(CCc2cccc(OC(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C15H17F3N2O4/c1-14(9-23-2)12(21)20(13(22)19-14)7-6-10-4-3-5-11(8-10)24-15(16,17)18/h3-5,8H,6-7,9H2,1-2H3,(H,19,22)/t14-/m1/s1 |
| InChIKey | HMZSERHVBBZMLX-CQSZACIVSA-N |
| XLogP | 2.08 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.31 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|