C14H23F3N2O2 — CID 97340849
1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-[(2S)-1,1,1-trifluoro-4,4-dimethylpentan-2-yl]urea (PubChem CID 97340849) has the molecular formula C14H23F3N2O2 and a molecular weight of 308.34 g/mol. Its IUPAC name is 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-[(2S)-1,1,1-trifluoro-4,4-dimethylpentan-2-yl]urea.
| Compound Name | 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-[(2S)-1,1,1-trifluoro-4,4-dimethylpentan-2-yl]urea |
|---|---|
| PubChem CID | 97340849 |
| Molecular Formula | C14H23F3N2O2 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 1-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3-[(2S)-1,1,1-trifluoro-4,4-dimethylpentan-2-yl]urea |
| SMILES | CC(C)(C)C[C@H](NC(=O)N[C@@H]1C=C[C@H](CO)C1)C(F)(F)F |
| InChI | InChI=1S/C14H23F3N2O2/c1-13(2,3)7-11(14(15,16)17)19-12(21)18-10-5-4-9(6-10)8-20/h4-5,9-11,20H,6-8H2,1-3H3,(H2,18,19,21)/t9-,10+,11-/m0/s1 |
| InChIKey | TXOXDEGGCAAREO-AXFHLTTASA-N |
| XLogP | 2.59 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|