C17H29N3O3 — CID 97340875
1-[(2R)-2-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-3-[(3R)-2,2,5,5-tetramethyloxolan-3-yl]urea (PubChem CID 97340875) has the molecular formula C17H29N3O3 and a molecular weight of 323.44 g/mol. Its IUPAC name is 1-[(2R)-2-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-3-[(3R)-2,2,5,5-tetramethyloxolan-3-yl]urea.
| Compound Name | 1-[(2R)-2-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-3-[(3R)-2,2,5,5-tetramethyloxolan-3-yl]urea |
|---|---|
| PubChem CID | 97340875 |
| Molecular Formula | C17H29N3O3 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | 1-[(2R)-2-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-3-[(3R)-2,2,5,5-tetramethyloxolan-3-yl]urea |
| SMILES | Cc1noc(C)c1[C@@H](C)CNC(=O)N[C@@H]1CC(C)(C)OC1(C)C |
| InChI | InChI=1S/C17H29N3O3/c1-10(14-11(2)20-22-12(14)3)9-18-15(21)19-13-8-16(4,5)23-17(13,6)7/h10,13H,8-9H2,1-7H3,(H2,18,19,21)/t10-,13+/m0/s1 |
| InChIKey | YMEWGJYFJJDKOT-GXFFZTMASA-N |
| XLogP | 3.04 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |