C17H30N4O2 — CID 97340949
1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[(3R)-2,2,5,5-tetramethyloxolan-3-yl]urea (PubChem CID 97340949) has the molecular formula C17H30N4O2 and a molecular weight of 322.45 g/mol. Its IUPAC name is 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[(3R)-2,2,5,5-tetramethyloxolan-3-yl]urea.
| Compound Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[(3R)-2,2,5,5-tetramethyloxolan-3-yl]urea |
|---|---|
| PubChem CID | 97340949 |
| Molecular Formula | C17H30N4O2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[(3R)-2,2,5,5-tetramethyloxolan-3-yl]urea |
| SMILES | Cc1cc(C)n(CCCNC(=O)N[C@@H]2CC(C)(C)OC2(C)C)n1 |
| InChI | InChI=1S/C17H30N4O2/c1-12-10-13(2)21(20-12)9-7-8-18-15(22)19-14-11-16(3,4)23-17(14,5)6/h10,14H,7-9,11H2,1-6H3,(H2,18,19,22)/t14-/m1/s1 |
| InChIKey | JUEYKSJAVGOXSX-CQSZACIVSA-N |
| XLogP | 2.54 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|