C15H26N2O3 — CID 97341149
(2S,3R)-4-methoxy-N-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]-3-methylbutan-2-amine (PubChem CID 97341149) has the molecular formula C15H26N2O3 and a molecular weight of 282.38 g/mol. Its IUPAC name is (2S,3R)-4-methoxy-N-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]-3-methylbutan-2-amine.
| Compound Name | (2S,3R)-4-methoxy-N-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]-3-methylbutan-2-amine |
|---|---|
| PubChem CID | 97341149 |
| Molecular Formula | C15H26N2O3 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | (2S,3R)-4-methoxy-N-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]-3-methylbutan-2-amine |
| SMILES | COCCOc1ccc(CN[C@@H](C)[C@@H](C)COC)cn1 |
| InChI | InChI=1S/C15H26N2O3/c1-12(11-19-4)13(2)16-9-14-5-6-15(17-10-14)20-8-7-18-3/h5-6,10,12-13,16H,7-9,11H2,1-4H3/t12-,13-/m0/s1 |
| InChIKey | GISCFEXRJDXMER-STQMWFEESA-N |
| XLogP | 1.87 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|