C17H35N3O4S — CID 97341177
tert-butyl (3R)-3-[(1R)-1-[3-(ethylsulfonylamino)propylamino]ethyl]piperidine-1-carboxylate (PubChem CID 97341177) has the molecular formula C17H35N3O4S and a molecular weight of 377.55 g/mol. Its IUPAC name is tert-butyl (3R)-3-[(1R)-1-[3-(ethylsulfonylamino)propylamino]ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[(1R)-1-[3-(ethylsulfonylamino)propylamino]ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 97341177 |
| Molecular Formula | C17H35N3O4S |
| Molecular Weight | 377.55 g/mol |
| Exact Mass | 377.23 |
| IUPAC Name | tert-butyl (3R)-3-[(1R)-1-[3-(ethylsulfonylamino)propylamino]ethyl]piperidine-1-carboxylate |
| SMILES | CCS(=O)(=O)NCCCN[C@H](C)[C@@H]1CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C17H35N3O4S/c1-6-25(22,23)19-11-8-10-18-14(2)15-9-7-12-20(13-15)16(21)24-17(3,4)5/h14-15,18-19H,6-13H2,1-5H3/t14-,15-/m1/s1 |
| InChIKey | XCPNLNDMXIOYGG-HUUCEWRRSA-N |
| XLogP | 1.94 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.55 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|