C20H21N5O5S — CID 97341998
4-methoxy-2-(methoxymethyl)-5-methyl-N-[(6S)-3-nitro-5,6,7,8-tetrahydroquinolin-6-yl]thieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 97341998) has the molecular formula C20H21N5O5S and a molecular weight of 443.49 g/mol. Its IUPAC name is 4-methoxy-2-(methoxymethyl)-5-methyl-N-[(6S)-3-nitro-5,6,7,8-tetrahydroquinolin-6-yl]thieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 4-methoxy-2-(methoxymethyl)-5-methyl-N-[(6S)-3-nitro-5,6,7,8-tetrahydroquinolin-6-yl]thieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 97341998 |
| Molecular Formula | C20H21N5O5S |
| Molecular Weight | 443.49 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 4-methoxy-2-(methoxymethyl)-5-methyl-N-[(6S)-3-nitro-5,6,7,8-tetrahydroquinolin-6-yl]thieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | COCc1nc(OC)c2c(C)c(C(=O)N[C@H]3CCc4ncc([N+](=O)[O-])cc4C3)sc2n1 |
| InChI | InChI=1S/C20H21N5O5S/c1-10-16-19(30-3)23-15(9-29-2)24-20(16)31-17(10)18(26)22-12-4-5-14-11(6-12)7-13(8-21-14)25(27)28/h7-8,12H,4-6,9H2,1-3H3,(H,22,26)/t12-/m0/s1 |
| InChIKey | ZDQJTPPIMPHHFF-LBPRGKRZSA-N |
| XLogP | 2.75 |
| TPSA | 129.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.49 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|