C15H18N6 — CID 97342089
N-[(2R)-4-pyrazol-1-ylbutan-2-yl]-3-(1H-1,2,4-triazol-5-yl)aniline (PubChem CID 97342089) has the molecular formula C15H18N6 and a molecular weight of 282.35 g/mol. Its IUPAC name is N-[(2R)-4-pyrazol-1-ylbutan-2-yl]-3-(1H-1,2,4-triazol-5-yl)aniline.
| Compound Name | N-[(2R)-4-pyrazol-1-ylbutan-2-yl]-3-(1H-1,2,4-triazol-5-yl)aniline |
|---|---|
| PubChem CID | 97342089 |
| Molecular Formula | C15H18N6 |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | N-[(2R)-4-pyrazol-1-ylbutan-2-yl]-3-(1H-1,2,4-triazol-5-yl)aniline |
| SMILES | C[C@H](CCn1cccn1)Nc1cccc(-c2ncn[nH]2)c1 |
| InChI | InChI=1S/C15H18N6/c1-12(6-9-21-8-3-7-18-21)19-14-5-2-4-13(10-14)15-16-11-17-20-15/h2-5,7-8,10-12,19H,6,9H2,1H3,(H,16,17,20)/t12-/m1/s1 |
| InChIKey | VZQCCGUBKLEQPC-GFCCVEGCSA-N |
| XLogP | 2.56 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |