C17H19N3O3S — CID 97342276
N-[(6S)-3-nitro-5,6,7,8-tetrahydroquinolin-6-yl]-3-propan-2-ylthiophene-2-carboxamide (PubChem CID 97342276) has the molecular formula C17H19N3O3S and a molecular weight of 345.42 g/mol. Its IUPAC name is N-[(6S)-3-nitro-5,6,7,8-tetrahydroquinolin-6-yl]-3-propan-2-ylthiophene-2-carboxamide.
| Compound Name | N-[(6S)-3-nitro-5,6,7,8-tetrahydroquinolin-6-yl]-3-propan-2-ylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 97342276 |
| Molecular Formula | C17H19N3O3S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | N-[(6S)-3-nitro-5,6,7,8-tetrahydroquinolin-6-yl]-3-propan-2-ylthiophene-2-carboxamide |
| SMILES | CC(C)c1ccsc1C(=O)N[C@H]1CCc2ncc([N+](=O)[O-])cc2C1 |
| InChI | InChI=1S/C17H19N3O3S/c1-10(2)14-5-6-24-16(14)17(21)19-12-3-4-15-11(7-12)8-13(9-18-15)20(22)23/h5-6,8-10,12H,3-4,7H2,1-2H3,(H,19,21)/t12-/m0/s1 |
| InChIKey | SZQSIUOCXOIYDB-LBPRGKRZSA-N |
| XLogP | 3.46 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|