About [(2S)-pent-4-yn-2-yl] 2-methyl-5-phenyl-1,3-thiazole-4-carboxylate
[(2S)-pent-4-yn-2-yl] 2-methyl-5-phenyl-1,3-thiazole-4-carboxylate (PubChem CID 97342349) has the molecular formula C16H15NO2S
and a molecular weight of 285.37 g/mol. Its IUPAC name is [(2S)-pent-4-yn-2-yl] 2-methyl-5-phenyl-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | [(2S)-pent-4-yn-2-yl] 2-methyl-5-phenyl-1,3-thiazole-4-carboxylate |
| PubChem CID | 97342349 |
| Molecular Formula | C16H15NO2S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | [(2S)-pent-4-yn-2-yl] 2-methyl-5-phenyl-1,3-thiazole-4-carboxylate |
| SMILES | C#CC[C@H](C)OC(=O)c1nc(C)sc1-c1ccccc1 |
| InChI | InChI=1S/C16H15NO2S/c1-4-8-11(2)19-16(18)14-15(20-12(3)17-14)13-9-6-5-7-10-13/h1,5-7,9-11H,8H2,2-3H3/t11-/m0/s1 |
| InChIKey | OGLVNIVNOSBVGS-NSHDSACASA-N |
| XLogP | 3.69 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-pent-4-yn-2-yl] 2-methyl-5-phenyl-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-pent-4-yn-2-yl] 2-methyl-5-phenyl-1,3-thiazole-4-carboxylate?
The IUPAC name of [(2S)-pent-4-yn-2-yl] 2-methyl-5-phenyl-1,3-thiazole-4-carboxylate (CID 97342349) is [(2S)-pent-4-yn-2-yl] 2-methyl-5-phenyl-1,3-thiazole-4-carboxylate.
What is the SMILES notation for [(2S)-pent-4-yn-2-yl] 2-methyl-5-phenyl-1,3-thiazole-4-carboxylate?
The canonical SMILES for [(2S)-pent-4-yn-2-yl] 2-methyl-5-phenyl-1,3-thiazole-4-carboxylate is C#CC[C@H](C)OC(=O)c1nc(C)sc1-c1ccccc1.
What is the InChIKey of [(2S)-pent-4-yn-2-yl] 2-methyl-5-phenyl-1,3-thiazole-4-carboxylate?
The InChIKey is OGLVNIVNOSBVGS-NSHDSACASA-N. The full InChI is InChI=1S/C16H15NO2S/c1-4-8-11(2)19-16(18)14-15(20-12(3)17-14)13-9-6-5-7-10-13/h1,5-7,9-11H,8H2,2-3H3/t11-/m0/s1.
What are the key properties of [(2S)-pent-4-yn-2-yl] 2-methyl-5-phenyl-1,3-thiazole-4-carboxylate?
[(2S)-pent-4-yn-2-yl] 2-methyl-5-phenyl-1,3-thiazole-4-carboxylate has a molecular weight of 285.37 g/mol, XLogP of 3.69, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-pent-4-yn-2-yl] 2-methyl-5-phenyl-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 97342349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).