C22H31N3O4 — CID 97342882
(3S)-3-[4-(2-methoxybenzoyl)piperazin-1-yl]-1-(oxan-4-yl)piperidin-2-one (PubChem CID 97342882) has the molecular formula C22H31N3O4 and a molecular weight of 401.51 g/mol. Its IUPAC name is (3S)-3-[4-(2-methoxybenzoyl)piperazin-1-yl]-1-(oxan-4-yl)piperidin-2-one.
| Compound Name | (3S)-3-[4-(2-methoxybenzoyl)piperazin-1-yl]-1-(oxan-4-yl)piperidin-2-one |
|---|---|
| PubChem CID | 97342882 |
| Molecular Formula | C22H31N3O4 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | (3S)-3-[4-(2-methoxybenzoyl)piperazin-1-yl]-1-(oxan-4-yl)piperidin-2-one |
| SMILES | COc1ccccc1C(=O)N1CCN([C@H]2CCCN(C3CCOCC3)C2=O)CC1 |
| InChI | InChI=1S/C22H31N3O4/c1-28-20-7-3-2-5-18(20)21(26)24-13-11-23(12-14-24)19-6-4-10-25(22(19)27)17-8-15-29-16-9-17/h2-3,5,7,17,19H,4,6,8-16H2,1H3/t19-/m0/s1 |
| InChIKey | YZYIUWDTKQHPFQ-IBGZPJMESA-N |
| XLogP | 1.62 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |