About methyl N-[2-[(3S)-3-(1-benzyl-3,5-dimethylpyrazol-4-yl)morpholin-4-yl]-2-oxoethyl]carbamate
methyl N-[2-[(3S)-3-(1-benzyl-3,5-dimethylpyrazol-4-yl)morpholin-4-yl]-2-oxoethyl]carbamate (PubChem CID 97343044) has the molecular formula C20H26N4O4
and a molecular weight of 386.45 g/mol. Its IUPAC name is methyl N-[2-[(3S)-3-(1-benzyl-3,5-dimethylpyrazol-4-yl)morpholin-4-yl]-2-oxoethyl]carbamate.
Molecular Properties
| Compound Name | methyl N-[2-[(3S)-3-(1-benzyl-3,5-dimethylpyrazol-4-yl)morpholin-4-yl]-2-oxoethyl]carbamate |
| PubChem CID | 97343044 |
| Molecular Formula | C20H26N4O4 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | methyl N-[2-[(3S)-3-(1-benzyl-3,5-dimethylpyrazol-4-yl)morpholin-4-yl]-2-oxoethyl]carbamate |
| SMILES | COC(=O)NCC(=O)N1CCOC[C@@H]1c1c(C)nn(Cc2ccccc2)c1C |
| InChI | InChI=1S/C20H26N4O4/c1-14-19(15(2)24(22-14)12-16-7-5-4-6-8-16)17-13-28-10-9-23(17)18(25)11-21-20(26)27-3/h4-8,17H,9-13H2,1-3H3,(H,21,26)/t17-/m1/s1 |
| InChIKey | KOWKZPIXJHFDKM-QGZVFWFLSA-N |
| XLogP | 1.80 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl N-[2-[(3S)-3-(1-benzyl-3,5-dimethylpyrazol-4-yl)morpholin-4-yl]-2-oxoethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[2-[(3S)-3-(1-benzyl-3,5-dimethylpyrazol-4-yl)morpholin-4-yl]-2-oxoethyl]carbamate?
The IUPAC name of methyl N-[2-[(3S)-3-(1-benzyl-3,5-dimethylpyrazol-4-yl)morpholin-4-yl]-2-oxoethyl]carbamate (CID 97343044) is methyl N-[2-[(3S)-3-(1-benzyl-3,5-dimethylpyrazol-4-yl)morpholin-4-yl]-2-oxoethyl]carbamate.
What is the SMILES notation for methyl N-[2-[(3S)-3-(1-benzyl-3,5-dimethylpyrazol-4-yl)morpholin-4-yl]-2-oxoethyl]carbamate?
The canonical SMILES for methyl N-[2-[(3S)-3-(1-benzyl-3,5-dimethylpyrazol-4-yl)morpholin-4-yl]-2-oxoethyl]carbamate is COC(=O)NCC(=O)N1CCOC[C@@H]1c1c(C)nn(Cc2ccccc2)c1C.
What is the InChIKey of methyl N-[2-[(3S)-3-(1-benzyl-3,5-dimethylpyrazol-4-yl)morpholin-4-yl]-2-oxoethyl]carbamate?
The InChIKey is KOWKZPIXJHFDKM-QGZVFWFLSA-N. The full InChI is InChI=1S/C20H26N4O4/c1-14-19(15(2)24(22-14)12-16-7-5-4-6-8-16)17-13-28-10-9-23(17)18(25)11-21-20(26)27-3/h4-8,17H,9-13H2,1-3H3,(H,21,26)/t17-/m1/s1.
What are the key properties of methyl N-[2-[(3S)-3-(1-benzyl-3,5-dimethylpyrazol-4-yl)morpholin-4-yl]-2-oxoethyl]carbamate?
methyl N-[2-[(3S)-3-(1-benzyl-3,5-dimethylpyrazol-4-yl)morpholin-4-yl]-2-oxoethyl]carbamate has a molecular weight of 386.45 g/mol, XLogP of 1.80, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[2-[(3S)-3-(1-benzyl-3,5-dimethylpyrazol-4-yl)morpholin-4-yl]-2-oxoethyl]carbamate is sourced from PubChem (CID 97343044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).