About 1-[(3S)-3-(2,3-dihydroindol-1-ylsulfonyl)piperidin-1-yl]-2-hydroxyethanone
1-[(3S)-3-(2,3-dihydroindol-1-ylsulfonyl)piperidin-1-yl]-2-hydroxyethanone (PubChem CID 97343708) has the molecular formula C15H20N2O4S
and a molecular weight of 324.40 g/mol. Its IUPAC name is 1-[(3S)-3-(2,3-dihydroindol-1-ylsulfonyl)piperidin-1-yl]-2-hydroxyethanone.
Molecular Properties
| Compound Name | 1-[(3S)-3-(2,3-dihydroindol-1-ylsulfonyl)piperidin-1-yl]-2-hydroxyethanone |
| PubChem CID | 97343708 |
| Molecular Formula | C15H20N2O4S |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 1-[(3S)-3-(2,3-dihydroindol-1-ylsulfonyl)piperidin-1-yl]-2-hydroxyethanone |
| SMILES | O=C(CO)N1CCC[C@H](S(=O)(=O)N2CCc3ccccc32)C1 |
| InChI | InChI=1S/C15H20N2O4S/c18-11-15(19)16-8-3-5-13(10-16)22(20,21)17-9-7-12-4-1-2-6-14(12)17/h1-2,4,6,13,18H,3,5,7-11H2/t13-/m0/s1 |
| InChIKey | JRNYWUWAEAXGQG-ZDUSSCGKSA-N |
| XLogP | 0.36 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(3S)-3-(2,3-dihydroindol-1-ylsulfonyl)piperidin-1-yl]-2-hydroxyethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3S)-3-(2,3-dihydroindol-1-ylsulfonyl)piperidin-1-yl]-2-hydroxyethanone?
The IUPAC name of 1-[(3S)-3-(2,3-dihydroindol-1-ylsulfonyl)piperidin-1-yl]-2-hydroxyethanone (CID 97343708) is 1-[(3S)-3-(2,3-dihydroindol-1-ylsulfonyl)piperidin-1-yl]-2-hydroxyethanone.
What is the SMILES notation for 1-[(3S)-3-(2,3-dihydroindol-1-ylsulfonyl)piperidin-1-yl]-2-hydroxyethanone?
The canonical SMILES for 1-[(3S)-3-(2,3-dihydroindol-1-ylsulfonyl)piperidin-1-yl]-2-hydroxyethanone is O=C(CO)N1CCC[C@H](S(=O)(=O)N2CCc3ccccc32)C1.
What is the InChIKey of 1-[(3S)-3-(2,3-dihydroindol-1-ylsulfonyl)piperidin-1-yl]-2-hydroxyethanone?
The InChIKey is JRNYWUWAEAXGQG-ZDUSSCGKSA-N. The full InChI is InChI=1S/C15H20N2O4S/c18-11-15(19)16-8-3-5-13(10-16)22(20,21)17-9-7-12-4-1-2-6-14(12)17/h1-2,4,6,13,18H,3,5,7-11H2/t13-/m0/s1.
What are the key properties of 1-[(3S)-3-(2,3-dihydroindol-1-ylsulfonyl)piperidin-1-yl]-2-hydroxyethanone?
1-[(3S)-3-(2,3-dihydroindol-1-ylsulfonyl)piperidin-1-yl]-2-hydroxyethanone has a molecular weight of 324.40 g/mol, XLogP of 0.36, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3S)-3-(2,3-dihydroindol-1-ylsulfonyl)piperidin-1-yl]-2-hydroxyethanone is sourced from PubChem (CID 97343708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).