C21H30N4O2 — CID 97344150
N-cyclopropyl-N-methyl-2-[4-[(3S)-2-oxo-1-phenylpiperidin-3-yl]piperazin-1-yl]acetamide (PubChem CID 97344150) has the molecular formula C21H30N4O2 and a molecular weight of 370.50 g/mol. Its IUPAC name is N-cyclopropyl-N-methyl-2-[4-[(3S)-2-oxo-1-phenylpiperidin-3-yl]piperazin-1-yl]acetamide.
| Compound Name | N-cyclopropyl-N-methyl-2-[4-[(3S)-2-oxo-1-phenylpiperidin-3-yl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 97344150 |
| Molecular Formula | C21H30N4O2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | N-cyclopropyl-N-methyl-2-[4-[(3S)-2-oxo-1-phenylpiperidin-3-yl]piperazin-1-yl]acetamide |
| SMILES | CN(C(=O)CN1CCN([C@H]2CCCN(c3ccccc3)C2=O)CC1)C1CC1 |
| InChI | InChI=1S/C21H30N4O2/c1-22(17-9-10-17)20(26)16-23-12-14-24(15-13-23)19-8-5-11-25(21(19)27)18-6-3-2-4-7-18/h2-4,6-7,17,19H,5,8-16H2,1H3/t19-/m0/s1 |
| InChIKey | OETOYFZRGHOAQG-IBGZPJMESA-N |
| XLogP | 1.42 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |